cas: 52450-18-7 — see every product listed under this CAS number, including other names
3'-Amino-3'-deoxythymidine, 98%, 98% (CAS 52450-18-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0DU-250mg |
| cas | 52450-18-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1206.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 52450-18-7) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: ADVCGXWUUOVPPB-XLPZGREQSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | ADVCGXWUUOVPPB-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)N |
Computed by PubChem (NCBI)