cas: 1443313-47-0 — see every product listed under this CAS number, including other names
3'-n-Butoxy-4'-fluoroacetophenone (CAS 1443313-47-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F399050-1G |
| cas | 1443313-47-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4777.50 Pln | |
| Fluorochem | 5g | 14190.85 Pln |
| delivery time | 3-4 weeks |
|---|
1-(3-butoxy-4-fluorophenyl)ethanone (CAS 1443313-47-0) is a chemical compound with the molecular formula C12H15FO2 and a molecular weight of 210.24 g/mol. IUPAC name: 1-(3-butoxy-4-fluorophenyl)ethanone. InChIKey: OSSYOKMJNLXVLJ-UHFFFAOYSA-N.
| Molecular formula | C12H15FO2 |
|---|---|
| Molecular weight | 210.24 g/mol |
| IUPAC name | 1-(3-butoxy-4-fluorophenyl)ethanone |
| InChIKey | OSSYOKMJNLXVLJ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=CC(=C1)C(=O)C)F |
Computed by PubChem (NCBI)