CAS 1156360-83-6 appears in our catalog under these names: 1-(2-Fluoro-4-methoxyphenyl)-2,2-dimethylpropan-1-one, 95%, 1-(2-Fluoro-4-methoxyphenyl)-2,2-dimethylpropan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(2-fluoro-4-methoxyphenyl)-2,2-dimethylpropan-1-one (CAS 1156360-83-6) is a chemical compound with the molecular formula C12H15FO2 and a molecular weight of 210.24 g/mol. IUPAC name: 1-(2-fluoro-4-methoxyphenyl)-2,2-dimethylpropan-1-one. InChIKey: DXTXQMRMCBSWRO-UHFFFAOYSA-N.
| Molecular formula | C12H15FO2 |
|---|---|
| Molecular weight | 210.24 g/mol |
| IUPAC name | 1-(2-fluoro-4-methoxyphenyl)-2,2-dimethylpropan-1-one |
| InChIKey | DXTXQMRMCBSWRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=C(C=C(C=C1)OC)F |
Computed by PubChem (NCBI)