CAS 1035261-07-4 is the registry number for Ethyl 2-(4-fluorophenyl)-2-methylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-(4-fluorophenyl)-2-methylpropanoate (CAS 1035261-07-4) is a chemical compound with the molecular formula C12H15FO2 and a molecular weight of 210.24 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-2-methylpropanoate. InChIKey: AZIDQFWQOZRJFX-UHFFFAOYSA-N.
| Molecular formula | C12H15FO2 |
|---|---|
| Molecular weight | 210.24 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-2-methylpropanoate |
| InChIKey | AZIDQFWQOZRJFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)