cas: 100846-28-4 — see every product listed under this CAS number, including other names
3,3',5,5'-Tetrachloro-2,2'-bipyridine, 95-<97% (CAS 100846-28-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5453-95-97-1g |
| cas | 100846-28-4 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4754.86 Pln | |
| Hoffman Fine Chemicals | 2,5g | 8091.60 Pln | |
| Hoffman Fine Chemicals | 5g | 12761.76 Pln | |
| Hoffman Fine Chemicals | 10g | 20232.74 Pln | |
| Hoffman Fine Chemicals | 25g | 42645.68 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine (CAS 100846-28-4) is a chemical compound with the molecular formula C10H4Cl4N2 and a molecular weight of 294.0 g/mol. IUPAC name: 3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine. InChIKey: LBWLQILBBQSTFR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl4N2 |
|---|---|
| Molecular weight | 294.0 g/mol |
| IUPAC name | 3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine |
| InChIKey | LBWLQILBBQSTFR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C2=C(C=C(C=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)