CAS 60069-96-7 appears in our catalog under these names: 2,2'-(Perchloro-1,2-phenylene)diacetonitrile, 95%, 2,2'-(Perchloro-1,2-phenylene)diacetonitrile. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 5g, 50mg, 500mg, 1000mg.
2-[2,3,4,5-tetrachloro-6-(cyanomethyl)phenyl]acetonitrile (CAS 60069-96-7) is a chemical compound with the molecular formula C10H4Cl4N2 and a molecular weight of 294.0 g/mol. IUPAC name: 2-[2,3,4,5-tetrachloro-6-(cyanomethyl)phenyl]acetonitrile. InChIKey: WXTXDIOFAZIXOA-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl4N2 |
|---|---|
| Molecular weight | 294.0 g/mol |
| IUPAC name | 2-[2,3,4,5-tetrachloro-6-(cyanomethyl)phenyl]acetonitrile |
| InChIKey | WXTXDIOFAZIXOA-UHFFFAOYSA-N |
| SMILES | C(C#N)C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)CC#N |
Computed by PubChem (NCBI)