CAS 100846-28-4 is the registry number for 3,3',5,5'-Tetrachloro-2,2'-bipyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine (CAS 100846-28-4) is a chemical compound with the molecular formula C10H4Cl4N2 and a molecular weight of 294.0 g/mol. IUPAC name: 3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine. InChIKey: LBWLQILBBQSTFR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl4N2 |
|---|---|
| Molecular weight | 294.0 g/mol |
| IUPAC name | 3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine |
| InChIKey | LBWLQILBBQSTFR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C2=C(C=C(C=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)