Products 100846-28-4

CAS 100846-28-4 is the registry number for 3,3',5,5'-Tetrachloro-2,2'-bipyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine (CAS 100846-28-4) is a chemical compound with the molecular formula C10H4Cl4N2 and a molecular weight of 294.0 g/mol. IUPAC name: 3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine. InChIKey: LBWLQILBBQSTFR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4Cl4N2
Molecular weight294.0 g/mol
IUPAC name3,5-dichloro-2-(3,5-dichloro-2-pyridinyl)pyridine
InChIKeyLBWLQILBBQSTFR-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)C2=C(C=C(C=N2)Cl)Cl)Cl

Computed by PubChem (NCBI)