3,3'-Disulfanediyldibenzoic acid, 98%
cas: 1227-49-2 — see every product listed under this CAS number, including other names
3,3'-Disulfanediyldibenzoic acid, 98% (CAS 1227-49-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A810694-1g |
| cas | 1227-49-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1399.44 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 25g | 1566.80 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 25g | 1502.83 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-[(3-carboxyphenyl)disulfanyl]benzoic acid (CAS 1227-49-2) is a chemical compound with the molecular formula C14H10O4S2 and a molecular weight of 306.4 g/mol. IUPAC name: 3-[(3-carboxyphenyl)disulfanyl]benzoic acid. InChIKey: GFUOAUHUTVPUIJ-UHFFFAOYSA-N.
| Molecular formula | C14H10O4S2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-[(3-carboxyphenyl)disulfanyl]benzoic acid |
| InChIKey | GFUOAUHUTVPUIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SSC2=CC=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,3'-disulfanediyldibenzoic acid, 3,3'-Dithiobisbenzoic acid, 3-[(3-carboxyphenyl)disulfanyl]benzoic acid, benzoic acid, 3,3'-dithiobis-, Benzoicacid, 3,3'-dithiobis-, 3,3'-Dithiobisbenzoic Acid, Technical Grade, NCIStruc1_001350, 3,3 inverted exclamation mark -Disulfanediyldibenzoic Acid, 3,3'-Dicarboxylic diphenyl disulfide, 3-[(3-carboxyphenyl)dis