CAS 343228-20-6 appears in our catalog under these names: 3,3'–Dimercapto–(1,1'–biphenyl)–4,4'–dicarboxylicacid, 3,3'-Dimercapto-[1,1'-biphenyl]-4,4'-dicarboxylic acid 98%, 3,3'-Dimercapto-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%, 98%, 3,3'-Dimercapto-[1,1'-Biphenyl]-4,4'-Dicarboxylic Acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-(4-carboxy-3-sulfanylphenyl)-2-sulfanylbenzoic acid (CAS 343228-20-6) is a chemical compound with the molecular formula C14H10O4S2 and a molecular weight of 306.4 g/mol. IUPAC name: 4-(4-carboxy-3-sulfanylphenyl)-2-sulfanylbenzoic acid. InChIKey: WMVWIXQVNGAZRU-UHFFFAOYSA-N.
| Molecular formula | C14H10O4S2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 4-(4-carboxy-3-sulfanylphenyl)-2-sulfanylbenzoic acid |
| InChIKey | WMVWIXQVNGAZRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)S)S)C(=O)O |
Computed by PubChem (NCBI)