3,4,5-Triethoxybenzoyl chloride, 95%
cas: 50915-97-4 — see every product listed under this CAS number, including other names
3,4,5-Triethoxybenzoyl chloride, 95% (CAS 50915-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1066082-250mg |
| cas | 50915-97-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 501.20 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 458.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3,4,5-triethoxybenzoyl chloride (CAS 50915-97-4) is a chemical compound with the molecular formula C13H17ClO4 and a molecular weight of 272.72 g/mol. IUPAC name: 3,4,5-triethoxybenzoyl chloride. InChIKey: JUICNMLFNLOFMZ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO4 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | 3,4,5-triethoxybenzoyl chloride |
| InChIKey | JUICNMLFNLOFMZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1OCC)OCC)C(=O)Cl |
Computed by PubChem (NCBI)