CAS 552843-48-8 is the registry number for (alphaS)-2-Chloro-alpha-(1-methoxy-1-methylethoxy)-benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 500mg.
Methyl (2S)-2-(2-chlorophenyl)-2-(2-methoxypropan-2-yloxy)acetate (CAS 552843-48-8) is a chemical compound with the molecular formula C13H17ClO4 and a molecular weight of 272.72 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(2-methoxypropan-2-yloxy)acetate. InChIKey: CYRIFACKLOAFIC-NSHDSACASA-N.
| Molecular formula | C13H17ClO4 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(2-methoxypropan-2-yloxy)acetate |
| InChIKey | CYRIFACKLOAFIC-NSHDSACASA-N |
| SMILES | CC(C)(OC)O[C@@H](C1=CC=CC=C1Cl)C(=O)OC |
Computed by PubChem (NCBI)