Products 2679836-99-6
CAS 2679836-99-6 is the registry number for 3,5-Dihydroxy-1-adamantyl 2-Chloroacrylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3,5-dihydroxy-1-adamantyl) 2-chloroprop-2-enoate (CAS 2679836-99-6) is a chemical compound with the molecular formula C13H17ClO4 and a molecular weight of 272.72 g/mol. IUPAC name: (3,5-dihydroxy-1-adamantyl) 2-chloroprop-2-enoate. InChIKey: CDXGQMWXYWGZTN-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO4 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | (3,5-dihydroxy-1-adamantyl) 2-chloroprop-2-enoate |
| InChIKey | CDXGQMWXYWGZTN-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OC12CC3CC(C1)(CC(C3)(C2)O)O)Cl |
Computed by PubChem (NCBI)