CAS 2338-20-7 appears in our catalog under these names: 3,4,5-Triiodobenzoic acid, 95%, 3,4,5-Triiodobenzoic acid/ 99.77% (existing batch purity), 3,4,5-Triiodobenzoic acid, 3,4,5-Triiodobenzoic acid 95%, 3,4,5-Triiodobenzoic acid, 95%, 95%. Offered by: Combi-blocks, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg.
3,4,5-triiodobenzoic acid (CAS 2338-20-7) is a chemical compound with the molecular formula C7H3I3O2 and a molecular weight of 499.81 g/mol. IUPAC name: 3,4,5-triiodobenzoic acid. InChIKey: UCBKDZNMPMBJAB-UHFFFAOYSA-N.
| Molecular formula | C7H3I3O2 |
|---|---|
| Molecular weight | 499.81 g/mol |
| IUPAC name | 3,4,5-triiodobenzoic acid |
| InChIKey | UCBKDZNMPMBJAB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)I)I)C(=O)O |
Computed by PubChem (NCBI)