cas: 1719-88-6 — see every product listed under this CAS number, including other names
3,4,5-Trimethoxybenzoic anhydride, 97%, 97% (CAS 1719-88-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 15g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IEX-10g |
| cas | 1719-88-6 |
| size | 10g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 549.20 Pln | |
| Chemat | 15g | 774.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 25g | 1134.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate (CAS 1719-88-6) is a chemical compound with the molecular formula C20H22O9 and a molecular weight of 406.4 g/mol. IUPAC name: (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate. InChIKey: LQJFTZJNDJDCKV-UHFFFAOYSA-N.
| Molecular formula | C20H22O9 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate |
| InChIKey | LQJFTZJNDJDCKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)OC(=O)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)