Products 66636-17-7

CAS 66636-17-7 appears in our catalog under these names: 3,4-Bis((tert-butoxycarbonyl)amino)benzoic acid, 97%, 97%, 3,4-Bis((tert-butoxycarbonyl)amino)benzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 66636-17-7) is a chemical compound with the molecular formula C17H24N2O6 and a molecular weight of 352.4 g/mol. IUPAC name: 3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: RQQDWMAMCZQDNK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O6
Molecular weight352.4 g/mol
IUPAC name3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
InChIKeyRQQDWMAMCZQDNK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)