CAS 66636-17-7 appears in our catalog under these names: 3,4-Bis((tert-butoxycarbonyl)amino)benzoic acid, 97%, 97%, 3,4-Bis((tert-butoxycarbonyl)amino)benzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 66636-17-7) is a chemical compound with the molecular formula C17H24N2O6 and a molecular weight of 352.4 g/mol. IUPAC name: 3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: RQQDWMAMCZQDNK-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O6 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | RQQDWMAMCZQDNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)