Products 73368-44-2

CAS 73368-44-2 is the registry number for (Acetylamino)((4-amino-3-methoxyphenyl)methyl)propanedioic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Diethyl 2-acetamido-2-[(4-amino-3-methoxyphenyl)methyl]propanedioate (CAS 73368-44-2) is a chemical compound with the molecular formula C17H24N2O6 and a molecular weight of 352.4 g/mol. IUPAC name: diethyl 2-acetamido-2-[(4-amino-3-methoxyphenyl)methyl]propanedioate. InChIKey: FYEGFDUEAHMSOR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O6
Molecular weight352.4 g/mol
IUPAC namediethyl 2-acetamido-2-[(4-amino-3-methoxyphenyl)methyl]propanedioate
InChIKeyFYEGFDUEAHMSOR-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC1=CC(=C(C=C1)N)OC)(C(=O)OCC)NC(=O)C

Computed by PubChem (NCBI)