Products 1951440-77-9

CAS 1951440-77-9 is the registry number for 1-Aminomethyl-3,4-dihydro-1h-isoquinoline-2-carboxylic acid tert-butyl ester oxalate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 1-(aminomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate;oxalic acid (CAS 1951440-77-9) is a chemical compound with the molecular formula C17H24N2O6 and a molecular weight of 352.4 g/mol. IUPAC name: tert-butyl 1-(aminomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate;oxalic acid. InChIKey: PTOQTYBQRMQVIS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O6
Molecular weight352.4 g/mol
IUPAC nametert-butyl 1-(aminomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate;oxalic acid
InChIKeyPTOQTYBQRMQVIS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2=CC=CC=C2C1CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)