3,4-Dichloronaphthalen-1-ol, 97%
cas: 58877-90-0 — see every product listed under this CAS number, including other names
3,4-Dichloronaphthalen-1-ol, 97% (CAS 58877-90-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A242231-250mg |
| cas | 58877-90-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1438.38 Pln | |
| BLDpharm | 50mg | 392.11 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 664.24 Pln | |
| BLDpharm | 1g | 1547.26 Pln | |
| Chemat | 50mg | 376.40 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1038.80 Pln | |
| Fluorochem | 50mg | 679.99 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1919.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3,4-dichloronaphthalen-1-ol (CAS 58877-90-0) is a chemical compound with the molecular formula C10H6Cl2O and a molecular weight of 213.06 g/mol. IUPAC name: 3,4-dichloronaphthalen-1-ol. InChIKey: FNSPLJCRSIZXGJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 3,4-dichloronaphthalen-1-ol |
| InChIKey | FNSPLJCRSIZXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2Cl)Cl)O |
Computed by PubChem (NCBI)