CAS 1574-18-1 is the registry number for 5,8–Dichloronaphthalen–1–ol. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5,8-dichloronaphthalen-1-ol (CAS 1574-18-1) is a chemical compound with the molecular formula C10H6Cl2O and a molecular weight of 213.06 g/mol. IUPAC name: 5,8-dichloronaphthalen-1-ol. InChIKey: KEGNUIZNBCHWLZ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 5,8-dichloronaphthalen-1-ol |
| InChIKey | KEGNUIZNBCHWLZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=C1)O)Cl)Cl |
Computed by PubChem (NCBI)