cas: 7474-78-4 — see every product listed under this CAS number, including other names
3,4-Diaminobenzenesulfonic acid, 95% (CAS 7474-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049429-1G |
| cas | 7474-78-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 50g | 383.22 Pln | |
| Fluorochem | 100g | 700.81 Pln | |
| Fluorochem | 500g | 3288.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,4-diaminobenzenesulfonic acid (CAS 7474-78-4) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 3,4-diaminobenzenesulfonic acid. InChIKey: FKSRSWQTEJTBMI-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 3,4-diaminobenzenesulfonic acid |
| InChIKey | FKSRSWQTEJTBMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)N)N |
Computed by PubChem (NCBI)