CAS 88-63-1 appears in our catalog under these names: 2,4-Diaminobenzenesulfonic acid, 98%, 2,4-Diaminobenzenesulfonic Acid, >95% (HPLC), 1,3–Phenylenediamine–4–sulfonic Acid, 1,3-Phenylenediamine-4-sulfonic Acid, >98.0%(HPLC)(T), 2,4-Diaminobenzenesulfonic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 2,5g, 250mg, 500mg, 500g.
2,4-diaminobenzenesulfonic acid (CAS 88-63-1) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 2,4-diaminobenzenesulfonic acid. InChIKey: JVMSQRAXNZPDHF-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 2,4-diaminobenzenesulfonic acid |
| InChIKey | JVMSQRAXNZPDHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)S(=O)(=O)O |
Computed by PubChem (NCBI)