CAS 88-45-9 appears in our catalog under these names: 2,5–Diaminobenzenesulfonic acid, 1,4-Phenylenediamine-2-sulfonic Acid, >98.0%(HPLC)(T), 2,5-Diaminobenzenesulfonic acid 95%, 2,5-DIAMINOBENZENESULFONIC ACID, >=97.0%, 2,5-Diaminobenzenesulfonic acid. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, HPC Standards. Available pack sizes: 100g, 500g, 5g, 25g, 250G, 50G, 1x1000mg, 10g.
2,5-diaminobenzenesulfonic acid (CAS 88-45-9) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 2,5-diaminobenzenesulfonic acid. InChIKey: HEAHMJLHQCESBZ-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 2,5-diaminobenzenesulfonic acid |
| InChIKey | HEAHMJLHQCESBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)O)N |
Computed by PubChem (NCBI)