3,4-Dichlorophenylboronic acid 98%
cas: 151169-75-4 — see every product listed under this CAS number, including other names
3,4-Dichlorophenylboronic acid 98% (CAS 151169-75-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153220-5g |
| cas | 151169-75-4 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 503.88 Pln | |
| Ambeed | 500g | 2239.38 Pln | |
| Ambeed | 1000g | 4403.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153220 |
(3,4-dichlorophenyl)boronic acid (CAS 151169-75-4) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (3,4-dichlorophenyl)boronic acid. InChIKey: JKIGHOARKAIPJI-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (3,4-dichlorophenyl)boronic acid |
| InChIKey | JKIGHOARKAIPJI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4-Dichlorobenzeneboronic Acid, 3,4-Dichlorophenylboronic acid, (3,4-dichlorophenyl)boronic Acid, 3,4-Dichlorophenylboronicacid, 3,4-Dichlorophenyl boronic acid, 3,4 dichlorobenzene boronic acid, 3,4-dichloro-phenyl boronic acid, (3,4-dichlorophenyl) boronic acid, Boronic acid, (3,4-dichlorophenyl)-, (3,4-dichlo