CAS 151169-75-4 appears in our catalog under these names: 3,4-Dichlorophenylboronic acid, 98%, 3,4-Dichlorophenylboronic Acid, 3,4-Dichlorophenylboronic acid/ 95+%, 3,4-Dichlorobenzeneboronic acid, 97% , 3,4-Dichlorophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, TRC, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 10g, 1000g, 25 g.
(3,4-dichlorophenyl)boronic acid (CAS 151169-75-4) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (3,4-dichlorophenyl)boronic acid. InChIKey: JKIGHOARKAIPJI-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (3,4-dichlorophenyl)boronic acid |
| InChIKey | JKIGHOARKAIPJI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)