3,4-Dichlorophenylboronic acid, 98%, 98%
cas: 151169-75-4 — see every product listed under this CAS number, including other names
3,4-Dichlorophenylboronic acid, 98%, 98% (CAS 151169-75-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112N64-1g |
| cas | 151169-75-4 |
| size | 1g |
| availability | 1500g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 500g | 1675.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,4-dichlorophenyl)boronic acid (CAS 151169-75-4) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (3,4-dichlorophenyl)boronic acid. InChIKey: JKIGHOARKAIPJI-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (3,4-dichlorophenyl)boronic acid |
| InChIKey | JKIGHOARKAIPJI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4-Dichlorobenzeneboronic Acid, 3,4-Dichlorophenylboronic acid, (3,4-dichlorophenyl)boronic Acid, 3,4-Dichlorophenylboronicacid, 3,4-Dichlorophenyl boronic acid, 3,4 dichlorobenzene boronic acid, 3,4-dichloro-phenyl boronic acid, (3,4-dichlorophenyl) boronic acid, Boronic acid, (3,4-dichlorophenyl)-, (3,4-dichlo