cas: 16200-50-3 — see every product listed under this CAS number, including other names
3,4-Diethyl-2-ethoxycarbonyl-5-methylpyrrole, >96.0%(GC) (CAS 16200-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2217-1G |
| cas | 16200-50-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 275.70 Pln | |
| TCI | 5g | 1013.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
Ethyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate (CAS 16200-50-3) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: ethyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate. InChIKey: YXAABSBFWADBRO-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | ethyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate |
| InChIKey | YXAABSBFWADBRO-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=C1CC)C(=O)OCC)C |
Computed by PubChem (NCBI)