cas: 2244893-49-8 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97%, 97% (CAS 2244893-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132O9L-100mg |
| cas | 2244893-49-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 702.80 Pln | |
| Chemat | 250mg | 1110.80 Pln | |
| Chemat | 1g | 2162.00 Pln | |
| Chemat | 5g | 6573.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2244893-49-8) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: 3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: MRRIMYHDASDOCL-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | MRRIMYHDASDOCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)F)O |
Computed by PubChem (NCBI)