Products 1631756-19-8
CAS 1631756-19-8 appears in our catalog under these names: 2,3-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 2,3-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1631756-19-8) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: OTLMATJLRMWZSU-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | OTLMATJLRMWZSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)F)F)O |
Computed by PubChem (NCBI)