CAS 2096336-27-3 appears in our catalog under these names: 4-(Cyclopentyloxy)-3,5-difluoro-2-methylphenylboronic acid, 97%, (4-(Cyclopentyloxy)-3,5-difluoro-2-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
(4-cyclopentyloxy-3,5-difluoro-2-methylphenyl)boronic acid (CAS 2096336-27-3) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: (4-cyclopentyloxy-3,5-difluoro-2-methylphenyl)boronic acid. InChIKey: BMKLLRBRMAQTHG-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (4-cyclopentyloxy-3,5-difluoro-2-methylphenyl)boronic acid |
| InChIKey | BMKLLRBRMAQTHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1C)F)OC2CCCC2)F)(O)O |
Computed by PubChem (NCBI)