cas: 107392-33-6 — see every product listed under this CAS number, including other names
3,4-Difluorobenzimidamide hydrochloride, 98% (CAS 107392-33-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237154-250MG |
| cas | 107392-33-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 2361.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-difluorobenzenecarboximidamide;hydrochloride (CAS 107392-33-6) is a chemical compound with the molecular formula C7H7ClF2N2 and a molecular weight of 192.59 g/mol. IUPAC name: 3,4-difluorobenzenecarboximidamide;hydrochloride. InChIKey: WIFHYQZBCRLTBT-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2N2 |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 3,4-difluorobenzenecarboximidamide;hydrochloride |
| InChIKey | WIFHYQZBCRLTBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=N)N)F)F.Cl |
Computed by PubChem (NCBI)