CAS 1170536-00-1 appears in our catalog under these names: 2,4-DIFLUORO-BENZAMIDINE HYDROCHLORIDE, 98%, 98%, 2,4-Difluorobenzimidamide hydrochloride, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 5g.
2,4-difluorobenzenecarboximidamide;hydrochloride (CAS 1170536-00-1) is a chemical compound with the molecular formula C7H7ClF2N2 and a molecular weight of 192.59 g/mol. IUPAC name: 2,4-difluorobenzenecarboximidamide;hydrochloride. InChIKey: WKFTUPMWPSKTKT-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2N2 |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 2,4-difluorobenzenecarboximidamide;hydrochloride |
| InChIKey | WKFTUPMWPSKTKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=N)N.Cl |
Computed by PubChem (NCBI)