CAS 2747919-22-6 is the registry number for 3-Chloro-5-(1,1-difluoroethyl)pyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5-(1,1-difluoroethyl)pyridin-2-amine (CAS 2747919-22-6) is a chemical compound with the molecular formula C7H7ClF2N2 and a molecular weight of 192.59 g/mol. IUPAC name: 3-chloro-5-(1,1-difluoroethyl)pyridin-2-amine. InChIKey: ZTDYPUDTTUUUGY-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2N2 |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 3-chloro-5-(1,1-difluoroethyl)pyridin-2-amine |
| InChIKey | ZTDYPUDTTUUUGY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(N=C1)N)Cl)(F)F |
Computed by PubChem (NCBI)