cas: 1025707-93-0 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-pyran-6-boronic acid pinacol ester 95% (stabilized with 1%BHT) (CAS 1025707-93-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192328-250mg |
| cas | 1025707-93-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 10g | 954.44 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 95% (stabilized with 1%BHT) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192328 |
2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1025707-93-0) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RNRIMDSCBRDPLC-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RNRIMDSCBRDPLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCO2 |
Computed by PubChem (NCBI)