cas: 1025707-93-0 — see every product listed under this CAS number, including other names
3,4-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran, 98%, 98% (CAS 1025707-93-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118QR-100g |
| cas | 1025707-93-0 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 6678.80 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1749.20 Pln | |
| Chemat | 50g | 3405.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1025707-93-0) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RNRIMDSCBRDPLC-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RNRIMDSCBRDPLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCO2 |
Computed by PubChem (NCBI)