cas: 113504-93-1 — see every product listed under this CAS number, including other names
3,4-Methylenedioxyphenyl isothiocyanate (CAS 113504-93-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009530-5G |
| cas | 113504-93-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 747.67 Pln | |
| Fluorochem | 100g | 4142.31 Pln | |
| Fluorochem | 1g | 268.67 Pln |
| delivery time | 3-4 weeks |
|---|
5-isothiocyanato-1,3-benzodioxole (CAS 113504-93-1) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 5-isothiocyanato-1,3-benzodioxole. InChIKey: UVVSPZKAEJHDCY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 5-isothiocyanato-1,3-benzodioxole |
| InChIKey | UVVSPZKAEJHDCY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=C=S |
Computed by PubChem (NCBI)