CAS 113504-93-1 appears in our catalog under these names: 3,4-Methylenedioxyphenyl isothiocyanate, 95%, 5-Isothiocyanatobenzo(d)(1,3)dioxole, 98%, 3,4-Methylenedioxyphenyl isothiocyanate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100g.
5-isothiocyanato-1,3-benzodioxole (CAS 113504-93-1) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 5-isothiocyanato-1,3-benzodioxole. InChIKey: UVVSPZKAEJHDCY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 5-isothiocyanato-1,3-benzodioxole |
| InChIKey | UVVSPZKAEJHDCY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=C=S |
Computed by PubChem (NCBI)