CAS 40991-34-2 appears in our catalog under these names: 1,2-Benzisothiazole-3-carboxylic acid, 97%, 1,2-Benzothiazole-3-carboxylic acid, Benzo[d]isothiazole-3-carboxylic acid 97%, 1,2-BENZISOTHIAZOLE-3-CARBOXYLIC ACID, 98%, 98%, 1,2-Benzisothiazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g, 100mg, 500mg, 25g.
1,2-benzothiazole-3-carboxylic acid (CAS 40991-34-2) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-3-carboxylic acid. InChIKey: KTORKRBAIRTBCP-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,2-benzothiazole-3-carboxylic acid |
| InChIKey | KTORKRBAIRTBCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)C(=O)O |
Computed by PubChem (NCBI)