Products 40991-34-2

CAS 40991-34-2 appears in our catalog under these names: 1,2-Benzisothiazole-3-carboxylic acid, 97%, 1,2-Benzothiazole-3-carboxylic acid, Benzo[d]isothiazole-3-carboxylic acid 97%, 1,2-BENZISOTHIAZOLE-3-CARBOXYLIC ACID, 98%, 98%, 1,2-Benzisothiazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g, 100mg, 500mg, 25g.

Structural formula: {0} (CAS {1})

1,2-benzothiazole-3-carboxylic acid (CAS 40991-34-2) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-3-carboxylic acid. InChIKey: KTORKRBAIRTBCP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO2S
Molecular weight179.20 g/mol
IUPAC name1,2-benzothiazole-3-carboxylic acid
InChIKeyKTORKRBAIRTBCP-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NS2)C(=O)O

Computed by PubChem (NCBI)