cas: 49850-16-0 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)-N-ethylaniline (CAS 49850-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006028-100MG |
| cas | 49850-16-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 1g | 1549.47 Pln |
| delivery time | 2-3 weeks |
|---|
N-ethyl-3,5-bis(trifluoromethyl)aniline (CAS 49850-16-0) is a chemical compound with the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. IUPAC name: N-ethyl-3,5-bis(trifluoromethyl)aniline. InChIKey: WOIXGFNIYODSEA-UHFFFAOYSA-N.
| Molecular formula | C10H9F6N |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | N-ethyl-3,5-bis(trifluoromethyl)aniline |
| InChIKey | WOIXGFNIYODSEA-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)