cas: 16588-74-2 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)phenyl Isocyanate, >98.0%(GC) (CAS 16588-74-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0766-5G |
| cas | 16588-74-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 542.72 Pln | |
| TCI | 25g | 1693.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-isocyanato-3,5-bis(trifluoromethyl)benzene (CAS 16588-74-2) is a chemical compound with the molecular formula C9H3F6NO and a molecular weight of 255.12 g/mol. IUPAC name: 1-isocyanato-3,5-bis(trifluoromethyl)benzene. InChIKey: NRSSOFNMWSJECS-UHFFFAOYSA-N.
| Molecular formula | C9H3F6NO |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 1-isocyanato-3,5-bis(trifluoromethyl)benzene |
| InChIKey | NRSSOFNMWSJECS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)N=C=O)C(F)(F)F |
Computed by PubChem (NCBI)