CAS 16588-74-2 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)phenyl isocyanate, 98%, 3,5-Bis(trifluoromethyl)phenyl isocyanate, 98% , 3,5-Bis(trifluoromethyl)phenyl Isocyanate, >98.0%(GC), 3,5-Bis(trifluoromethyl)phenylisocyanate 98%, 3,5-BIS(TRIFLUOROMETHYL)PHENYL ISOCYANAT. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 250mg.
1-isocyanato-3,5-bis(trifluoromethyl)benzene (CAS 16588-74-2) is a chemical compound with the molecular formula C9H3F6NO and a molecular weight of 255.12 g/mol. IUPAC name: 1-isocyanato-3,5-bis(trifluoromethyl)benzene. InChIKey: NRSSOFNMWSJECS-UHFFFAOYSA-N.
| Molecular formula | C9H3F6NO |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 1-isocyanato-3,5-bis(trifluoromethyl)benzene |
| InChIKey | NRSSOFNMWSJECS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)N=C=O)C(F)(F)F |
Computed by PubChem (NCBI)