cas: 16588-74-2 — see every product listed under this CAS number, including other names
3,5-Di(trifluoromethyl)phenyl isocyanate, 98%, 98% (CAS 16588-74-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WET-1g |
| cas | 16588-74-2 |
| size | 1g |
| availability | 967.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 100g | 1389.20 Pln | |
| Chemat | 250mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-isocyanato-3,5-bis(trifluoromethyl)benzene (CAS 16588-74-2) is a chemical compound with the molecular formula C9H3F6NO and a molecular weight of 255.12 g/mol. IUPAC name: 1-isocyanato-3,5-bis(trifluoromethyl)benzene. InChIKey: NRSSOFNMWSJECS-UHFFFAOYSA-N.
| Molecular formula | C9H3F6NO |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 1-isocyanato-3,5-bis(trifluoromethyl)benzene |
| InChIKey | NRSSOFNMWSJECS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)N=C=O)C(F)(F)F |
Computed by PubChem (NCBI)