cas: 19715-19-6 — see every product listed under this CAS number, including other names
3,5-Bis-tert-butylsalicylic acid, 95%, 95% (CAS 19715-19-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 75g, 250g, 1kg, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AMD-50g |
| cas | 19715-19-6 |
| size | 50g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 102.80 Pln | |
| Chemat | 75g | 122.00 Pln | |
| Chemat | 250g | 198.80 Pln | |
| Chemat | 1kg | 650.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 500g | 374.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-ditert-butyl-2-hydroxybenzoic acid (CAS 19715-19-6) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: 3,5-ditert-butyl-2-hydroxybenzoic acid. InChIKey: ZWQBZEFLFSFEOS-UHFFFAOYSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | 3,5-ditert-butyl-2-hydroxybenzoic acid |
| InChIKey | ZWQBZEFLFSFEOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C(=O)O |
Computed by PubChem (NCBI)