CAS 945426-71-1 is the registry number for (E)-3-(But-2-enoyl)-2,4,4-trimethylcyclohex-2-en-1-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[(E)-but-2-enoyl]-2,4,4-trimethylcyclohex-2-en-1-yl] acetate (CAS 945426-71-1) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: [3-[(E)-but-2-enoyl]-2,4,4-trimethylcyclohex-2-en-1-yl] acetate. InChIKey: GEDDTPMAMRHVHC-VOTSOKGWSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | [3-[(E)-but-2-enoyl]-2,4,4-trimethylcyclohex-2-en-1-yl] acetate |
| InChIKey | GEDDTPMAMRHVHC-VOTSOKGWSA-N |
| SMILES | C/C=C/C(=O)C1=C(C(CCC1(C)C)OC(=O)C)C |
Computed by PubChem (NCBI)