CAS 1184986-45-5 appears in our catalog under these names: Gemfibrozil-d6, Gemfibrozil-d6, >95% (HPLC), Gemfibrozil-d6 (2,2-dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Gemfibrozil–d6, Gemfibrozil-d6, 98.00%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 1mg, 50mg, 5mg, 0,05g, 0,01g, 500ug, 5 mg.
5-(2,5-dimethylphenoxy)-2,2-bis(trideuteriomethyl)pentanoic acid (CAS 1184986-45-5) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 256.37 g/mol. IUPAC name: 5-(2,5-dimethylphenoxy)-2,2-bis(trideuteriomethyl)pentanoic acid. InChIKey: HEMJJKBWTPKOJG-LIJFRPJRSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 256.37 g/mol |
| IUPAC name | 5-(2,5-dimethylphenoxy)-2,2-bis(trideuteriomethyl)pentanoic acid |
| InChIKey | HEMJJKBWTPKOJG-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])C(CCCOC1=C(C=CC(=C1)C)C)(C(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)