cas: 197223-39-5 — see every product listed under this CAS number, including other names
3,5-DI-T-Butylphenylboronic Acid, 98%, 98% (CAS 197223-39-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AOE-250mg |
| cas | 197223-39-5 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 50g | 611.60 Pln | |
| Chemat | 100g | 1096.40 Pln | |
| Chemat | 250g | 2267.60 Pln | |
| Chemat | 500g | 3921.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-ditert-butylphenyl)boronic acid (CAS 197223-39-5) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: (3,5-ditert-butylphenyl)boronic acid. InChIKey: RPCBIEHUQSGPNA-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | (3,5-ditert-butylphenyl)boronic acid |
| InChIKey | RPCBIEHUQSGPNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)