Products 197223-39-5
CAS 197223-39-5 appears in our catalog under these names: 3,5-Di-t-butylphenylboronic acid, 98%, (3,5–Di–tert–butylphenyl)boronic acid (contains varying amounts of Anhydride ), (3,5-Di-tert-butylphenyl)boronic acid, 3,5-Di-tert-butylphenylboronic Acid (contains varying amounts of Anhydride), (3,5-Di-tert-butylphenyl)boronic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 200mg, 500mg, 500g.
(3,5-ditert-butylphenyl)boronic acid (CAS 197223-39-5) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: (3,5-ditert-butylphenyl)boronic acid. InChIKey: RPCBIEHUQSGPNA-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | (3,5-ditert-butylphenyl)boronic acid |
| InChIKey | RPCBIEHUQSGPNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3,5-Di-tert-butylphenyl)boronic acid, 3,5-Di-t-butylphenylboronic acid, (3,5-ditert-butylphenyl)boronic Acid, 3,5-di-tert-butylphenylboronic acid, Boronic acid, B-[3,5-bis(1,1-dimethylethyl)phenyl]-, 3,5-di-tert-butylbenzeneboronic acid, 3,5-bis(tert-butyl)phenylboronic acid, Boronic acid, [3,5-bis(1,1-dimethylethyl)phenyl]-, (3,5-Di-t, (3,5-Di-tert-butylphenyl)boronic acid (contains varying amounts of Anhydride )