CAS 871333-97-0 is the registry number for 4,4-Dimethylcyclohexa-1,5-dienylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 871333-97-0) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: 2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CJBWRIUXENKJRO-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | 2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CJBWRIUXENKJRO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(C=C2)(C)C |
Computed by PubChem (NCBI)