cas: 1620-64-0 — see every product listed under this CAS number, including other names
3,5-DI-TERT-BUTYL-4-HYDROXYBENZOIC ACID, ETHYL ESTER, 95%, 95% (CAS 1620-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SM4-250mg |
| cas | 1620-64-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1566.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3,5-ditert-butyl-4-hydroxybenzoate (CAS 1620-64-0) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: ethyl 3,5-ditert-butyl-4-hydroxybenzoate. InChIKey: ACGYFGHQFAXLCI-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | ethyl 3,5-ditert-butyl-4-hydroxybenzoate |
| InChIKey | ACGYFGHQFAXLCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)