CAS 69679-30-7 appears in our catalog under these names: Decyl 4-hydroxybenzoate, 95%, Decyl 4–hydroxybenzoate, Benzoic acid, 4-hydroxy-, decyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
Decyl 4-hydroxybenzoate (CAS 69679-30-7) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: decyl 4-hydroxybenzoate. InChIKey: GMMXJVUYXPXLPY-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | decyl 4-hydroxybenzoate |
| InChIKey | GMMXJVUYXPXLPY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)