CAS 1620-64-0 appears in our catalog under these names: Ethyl 3,5-di-tert-butyl-4-hydroxybenzoate, 95%, Ethyl 3,5–di–tert–butyl–4–hydroxybenzoate, ethyl 3,5-di-tert-butyl-4-hydroxybenzoate, 3,5-DI-TERT-BUTYL-4-HYDROXYBENZOIC ACID, ETHYL ESTER, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g, 2g, 10g.
Ethyl 3,5-ditert-butyl-4-hydroxybenzoate (CAS 1620-64-0) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: ethyl 3,5-ditert-butyl-4-hydroxybenzoate. InChIKey: ACGYFGHQFAXLCI-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | ethyl 3,5-ditert-butyl-4-hydroxybenzoate |
| InChIKey | ACGYFGHQFAXLCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)